I. Arrhenius Acid-Base Definition
A. Acids: proton generators in water (H+ are the acidic species)Examples: HCl, H2SO4 e.g.: HCl <--> H+ + Cl-
B. Bases: Hydroxide ion generators in water (OH- are the basic species)Examples: NaOH, NH3 e.g.: NH3 + H2O <--> NH4+ + OH-
C. UnexplainablesWhat about carbonate acting as a base?
CO32- + 2 HC2H3O2 --> CO2 + H2O + 2 C2H3O2-
=> carbonate is a base, but no hydroxide is generated.
II. Brönsted-Lowry Acid-Base Definition
A. Acids: proton donorsExamples: HCl, H2SO4
e.g.:
| HCl + | H2O | <--> | H3O+ + | Cl- |
| acid | base | C.A. | C.B. |
C.A. = conjugate acid ; C.B. = conjugate base
B. Bases: proton acceptorsExamples: NaOH, NH3
e.g.:
| NH3 + | H2O | <--> | NH4+ + | OH- |
| base | acid | C.A. | C.B. |
C. Water: special case!It is amphoteric, since it can act as an acid or as a base.
Self ionization: H2O <--> H+ + OH-
III. Definition of extent of ionization
A. Self ionization of water: define equilibrium constant KwKw = [H+][OH-]/[H2O] = [H+][OH-] because the concentration of water is so great (as the solvent) that it can be considered constant (change in[H2O]<<<<[H2O]). Also, water is a pure liquid, and can be omitted from K.
B. AcidsKa = [H3O+][A-]/[H2O][HA] ; Ka (approximately)= [H+][A-]/[HA]1. Keq of acids in water: HA + H2O <--> H3O+ + A-
simplifications: H3O+= H+ and [H2O] = Constant
The size of Ka indicates the extent
of ionization of HA and thus its strength. Units of Ka,
Kw (and Kb) are consistent throughout
the discussion, so are not explicitly shown.
The ionization proceeds essentially to completion, therefore [HA] is very small and hard to measure; Ka is very hard to determine.2. Strong Acids (Ka>>>>1): HCl, H2SO4, HNO3, HClO4
The ionization is far from complete. All components are measureable and Ka can be determined.3. Weak acids (Ka<1): HSO4-, HF, HC2H3O2, HCN, HNO2, HClO
4. General Rulesa. A strong acid has a weak conjugate base (as compared to H2O)
b. A weak acid has a strong conjugate base (as compared to H2O)
IV. Convenient measure of [H+] in aqueous solution => the pH scale
A. Definition: pH = -log[H+]e.g.: for a solution of [H+] = 1.0 x 10-6 M
pH = -log(1.00 x 10-6 M) = 6.00
1. Rule of Significant Figures With Logarithms: The number of
significant figuresin the concentration should equal the number
of significant digits in the logarithm.
B. pH scaleNeutral Solution: pure water
Kw = [H+][OH-]= 1.0 x 10-14
[H+] = [OH-] = 1.0 x 10-7
pH = -log(1.0 x 10-7) = 7.00 => midpoint of the scale
Max. basicity => pH = 14
Max. acidity => pH = 0

C. Can also define complement of pH: pOH = -log[OH-]e.g. a solution where [H+] = 1.0 x 10-6M ; pH = 6.00 and
Kw = [H+][OH-] = 1.0 x 10-14 = (1.0 x 10-6)[OH-]
[OH-] = 1.0 x 10-14/1.0 x 10-6= 1.0
x 10-8 M ; pOH = 8.00
D. General Relationship between pH and pOHpKw = -log(1.0 x 10-14) = 14.00
pH + pOH = pKw = 14.00

V. Calculation of pH of acidic solutions
A. Strong acids1. 0.20 M HCl
Reactions:
(1) HCl <--> H+ + Cl- ; Ka >>>1 (HCl ionizes completely)
(2) H2O <--> H+ + OH- ; Kw = 1.0 x 10-14
Ka >>>Kw so max. [H+] = [HCl]o because HCl ionizes completely
pH = -log(0.20) = 0.70
Reactions:2. 2.0 x 10-9 M HCl
(1) HCl <--> H+ + Cl- ; [H+] = [HCl]o = 2.0 x 10-9 M
(2) H2O <--> H+ + OH- ; [H+] = 1.0 x 10-7 M
Reaction 2 dominates because [H+] from HCl << [H+] from water
=> the solution is too dilute to significantly affect [H+]
B. Weak AcidsTreat as standard equilibrium problems.
Reactions:1. 0.20 M solution of acetic acid (HC2H3O2)
(1) HC2H3O2 <--> H+ + C2H3O2- ; Ka = 1.8 x 10-5
(2) H2O <--> H+ + OH- ; Kw = 1.0 x 10-14
Ka > Kw therefore reaction 1 dominates
| HC2H3O2 | <--> | H+ + | C2H3O2- | ||
| initial | 0.20 | 0 | 0 | M | |
| change | -x | +x | +x | M | |
| eq. | 0.20 - x | x | x | M |
Ka = [H+][C2H3O2-]/[HC2H3O2]
1.8 x 10-5 = (x)(x)/(0.20 - x) ; assume that 0.20 - x
= 0.20
x2 = (0.20)(1.8 x 10-5)
x = 0.0019 M = [H+] = [C2H3O2-]
pH = -log(0.0019) = 2.72
5% rule: can assume Y - x = Y if (x/Y)100 is less than 5%2. Check asumption with 5% rule
(x/[HC2H3O2]o)100
= (0.0019/0.20)100 = 0.95 % YES!
C. Compare strong and weak acids and resultant pH's
| Acid solution | pH | [H+] (M) | |
| strong | 0.20 M HCl | 0.70 | 0.20 |
| weak | 0.20 M HC2H3O2 | 2.72 | 0.0019 |
There is a difference of over two pH units when ionization is essentially complete (HCl) and when one out of every 100 molecules ionizes (HC2H3O2).
D. Percent Dissociation (Percent Ionization)% = ([H+]eq/[HA]o)1001. Definition and calculation
e.g. for 0.20 M HCl
% = (0.20/0.20) = 100%
e.g. for 0.20 M HC2H3O2
% = (0.0019/0.20) = 0.95%
2. Effect of concentration or dilution on %
| [HC2H3O2]o |
|
|
|
| 1.00 | 2.37 | 0.0042 | 0.42 |
| 0.20 | 2.72 | 0.0019 | 0.95 |
| 0.0010 | 3.87 | 0.00013 | 13 |
The percent dissociation increases as the solution becomes more dilute.
Relate to LeChatlier's Principle
HC2H3O2 + H2O <--> C2H3O2- + H3O+
Get increasing relative amounts of water to acetic acid as [HC2H3O2]
decreases, therefore shifts equilibrium to the right.
VI. Calculation of pH of basic solutions
A. Strong bases: treat analogously to strong acidsGeneric case: B + H2O --> BH+ + OH-
Kb = [BH+][OH-]/[B][H2O]
=> Kb (approximately)= [BH+][OH-]/[B]
Reactions:1. 0.20 M NaOH
(1) NaOH --> Na+ + OH- ; Kb >>>1 (NaOH ionizes completely)
(2) H2O <--> H+ + OH- ; Kw = 1.0 x 10-14
Ka >>>Kw so max. [OH-] = [NaOH]o because NaOH ionizes completely
pOH = -log(0.20) = 0.70
pH = 14.00 - 0.70 = 13.30
Reactions:2. 2.0 x 10-9 M NaOH
(1) NaOH --> Na+ + OH- ; [OH-] = [NaOH]o = 2.0 x 10-9 M
(2) H2O <--> H+ + OH- ; [OH-] = 1.0 x 10-7 M
Reaction 2 dominates because [OH-] from NaOH << [OH-] from water.
=> the solution is too dilute to significantly affect [OH-]
B. Weak basesTreat as standard equilibrium problems.
Reactions:1. 0.20 M solution of ammonia (NH3)
(1) NH3 + H2O <--> NH4+ + OH- ; Kb = 1.8 x 10-5
(2) H2O <--> H+ + OH- ; Kw = 1.0 x 10-14
Kb > Kw , therefore reaction 1 dominates
| NH3 + | H2O <--> | NH4+ + | OH- | ||
| initial | 0.20 | C | 0 | 0 | M |
| change | -x | -x | +x | +x | M |
| eq. | 0.20 - x | C | x | x | M |
Kb = [NH4+][OH-]/[NH3]
= (x)(x)/(0.20-x) = 1.8 x 10-5
x2 = (0.20)(1.8 x 10-5)
x = 0.0019 M = [NH4+] = [OH-]
pOH = -log(0.0019) = 2.72
pH = 14.00 - 2.72 = 11.28
5% rule: (0.0019/0.20)100 = 0.95% YES!
D. Rule about percent dissociation holds for weak bases as well.
VII. Polyprotic acids
A. Sulfuric acid (H2SO4)Equilibria in solution:
(1) H2SO4 <--> H+ + HSO4- ; Ka >>>> 1 (complete ionization)
(2) HSO4- <--> H+ + SO42- ; Ka = 1.2 x 10-2
=> bisulfate is a weak acid: why?
Consider it as an electrostatic problem. Removing a positive charge
from a negative species is more difficult than removing a positive charge
from a neutral species.
B. Phosphoric acid (H3PO4)Equilibria in solution:
(1) H3PO4 <--> H+ + H2PO4- ; Ka = 7.5 x 10-3
(2) H2PO4- <--> H+ + HPO42- ; Ka = 6.2 x 10-8
(3) HPO42- <--> H+ + PO43-
; Ka = 4.8 x 10-13
C. General rules1. Each successive ionization of a polyprotic acid is more difficult and the ionization constant is smaller.
2. Simplification: Consider only the first ionization when solving problems at this level.
VIII. Salt solutions and pH
A. Strong acid-strong basee.g. NaCl (aq)
Ans. Cl- from HCl (strong acid)1. Ask from what acid did the anion derive.
Cl- is the conjugate base (C.B.) of HCl
Ans. Na+ from NaOH (strong base)2. Ask from what base did the cation derive.
Na+ is the conjugate acid (C.A.) of NaOH
3. Equation of salt formation: (thought experiment)
| NaOH + | HCl | --> H2O + | Na+ + | Cl- | |
| SB | SA | C.A. | C.B. |
e.g. NaC2H3O24. The salt of a strong acid and a strong base is composed of a weak C.A., C.B. pair, therefore the solution will be neutral (pH = 7.00).B. Weak acid-strong base
1. C2H3O2- derives from acetic acid (HC2H3O2), a weak acid
2. Na+ derives from NaOH, a strong base
| NaOH + | HC2H3O2 | --> H2O + | Na+ + | C2H3O2- | |
| SB | WA | CA | CB |
3. Sodium cations have no affinity for H+ or OH- (CA of a SB), but acetate does have a significant affinity for H+ (CB of a WA).
Where will acetate get protons? from water
C2H3O2- + H2O <--> HC2H3O2 + OH- occurs in solution
=> the solution will be basic
Kb = [HC2H3O2][OH-]/[C2H3O2-]a. Determining Kb of the conjugate base:
Known eq. constants: Ka = [H+][C2H3O2-]/[HC2H3O2] ; Kw = [H+][OH-]
Can we combine Ka and Kw to get Kb? Yes.
Kb = Kw/Ka = 1.0 x 10-14/1.8 x 10-5 = 5.6 x 10-10
e.g. 0.20 M NaC2H3O2b. Calculating a specific pH:
| C2H3O2- + | H2O <--> | HC2H3O2 + | OH- | occurs in solution |
| 0.20 | C | 0 | 0 | M initial |
| -x | -x | +x | +x | M change |
| 0.20-x | C | x | x | M final |
Kb = 5.6 x 10-10 = [HC2H3O2][OH-]/[C2H3O2-]
= (x)(x)/0.20-x = x2/0.20
x = 1.06 x 10-5 M = [OH-]
pOH = -log(1.06 x 10-5) = 4.98
pH = 14.00 - 4.98 = 9.02
C. Strong acid-weak basee.g. NH4Cl
1. Cl- derives from HCl, a strong acid
2. NH4+ derives from NH3, a weak base
| NH3 + | HCl | --> | NH4+ + | Cl- |
| WB | SA | C.A. | C.B. |
NH4+ --> H+ + NH3 occurs in solution3. Chloride anions have no affinity for H+ or OH- (CB of a SA), but ammonium ions have only a moderate affinity fro protons (CA of a WB). Ammonium ions will partially ionize to produce H+ in solution.
=> the solution will be acidic
Follow the same reasoning used for Kb of a conjugate base.a. Determining Ka of the conjugate acid:
e.g. 0.10 M NH4Clb. Calculating a specific pH:
| NH4+ | --> | H+ + | NH3 | occurs in solution |
| 0.10 | 0 | 0 | M initial | |
| -x | +x | +x | M change | |
| 0.10-x | x | x | M final |
Ka = 5.6 x 10-10
= [H+][NH3]/[NH4+]
= (x)(x)/0.10-x = x2/0.10
x = 7.5 x 10-6 M = [H+]
pH = -log(7.5 x 10-6) = 5.13
D. Weak acid-weak basee.g. ammonium acetate (NH4C2H3O2)
1. C2H3O2- derives from acetic acid, a weak acid
2. NH4+ derives from ammonia, a weak base
| NH3 + | HC2H3O2 | --> | NH4+ + | C2H3O2- |
| WB | WA | C.A. | C.B. |
NH4+ --> H+ + NH3 occurs in solution, and3. Both the conjugate acid and the conjugate base will contribute to the final pH of the solution.
Must compare the Ka and Kb of the CA and CB.a. Determining the pH of a solution:
b. General Trends: Can compare Ka and Kbdirectly since they are related to CA and CB K's via Kw (Kb = Kw/Ka)1. Ka > Kb ; [H+] > [OH-] and the solution will be acidic
2. Ka < Kb ; [H+] < [OH-] and the solution will be basic
3. Ka = Kb ; [H+] = [OH-] and the solution will be neutral1. As Ka of a weak acid gets larger, Kbof the CB gets smaller
2. As Kb of a weak base gets larger, Kaof the CA gets smaller
3. Relationship:
|
|
|
|
|
|
|
< 7.00 |
|
|
|
> 7.00 |
|
|
|
= 7.00 |
IX. Salts of Polyprotic Acids
These can be treated like other salts.
e.g. Phosphoric acid and its salts: H3PO4; NaH2PO4; Na2HPO4; Na3PO4
Compare equilibrium constants for the possible processes:
| Eq. Name | Value | Equilibrium |
| Ka1 | 7.5 x 10-3 | H3PO4 <--> H+ + H2PO4- |
| Ka2 | 6.2 x 10-8 | H2PO4- <--> H+ + HPO42- |
| Ka3 | 4.8 x 10-13 | HPO42- <--> H+ + PO4-3 |
| Kb1 | 0.021 | PO4-3 + H2O <--> HPO42- + OH- |
| Kb2 | 1.6 x 10-7 | HPO42- + H2O <--> H2PO4- + OH- |
| Kb3 | 1.3 x 10-12 | H2PO4- + H2O <--> H3PO4 + OH- |
Choose the equilibrium with the largest K for the salt given.
Ex. 1: What is the pH of a 0.20 M solution of Na3PO4?
Dominant equilibrium: PO4-3 + H2O
<--> HPO42- + OH- ; K
b1 = 0.021
| PO4-3 + | H2O <--> | HPO42- + | OH- | ||
| initial | 0.20 | C | 0 | 0 | M |
| change | -x | -x | +x | +x | M |
| eq. | 0.20 - x | C | x | x | M |
Because K b1 is greater than 10-3, you CANNOT use the 5% rule to simplify the math!
0.021 = (x)(x)/(0.20-x)
x2 + 0.021x - 0.0042 = 0
x = [-0.021 + (0.0004 + 0.0168)1/2]/2
x = (0.1313-0.021)/2 = 0.055 M = [H+]
pH = 14.00 - (-log(0.055)) = 14.00-1.26 = 12.74
Na3PO4 is a basic salt.
Ex. 2: What is the pH of a 0.20 M NaH2PO4 solution?
Possible equilibria: H2PO4- <--> H+ + HPO42- ; Ka2 = 6.2 x 10-8
H2PO4- + H2O <--> H3PO4 + OH- ; Kb3 = 1.3 x 10-12
The first one (Ka2) is dominant; Ka2 > Kb3
| H2PO4- | <--> | HPO42- + | H+ | ||
| initial | 0.20 | 0 | 0 | M | |
| change | -x | +x | +x | M | |
| eq. | 0.20 - x | x | x | M |
6.2 x 10-8 = (x)(x)/(0.20-x)
x2 = (0.20)(6.2 x 10-8) = 1.24 x 10-8
x = 1.1 x 10-4 M = [H+]
pH = -log(1.1 x 10-4) = 3.95
NaH2PO4 is an acidic salt.
Ex. 3: What is the pH of a 0.20 M Na2HPO4 solution?
Possible equilibria: HPO42- <--> H+ + PO4-3 ; Ka3 = 4.8 x 10-13
HPO42- + H2O <--> H2PO4- + OH- ; Kb2 = 1.6 x 10-7
The second one (Kb2) is dominant; Kb2 > Ka3
| HPO42- + | H2O <--> | H2PO4- + | OH- | ||
| initial | 0.20 | C | 0 | 0 | M |
| change | -x | -x | +x | +x | M |
| eq. | 0.20 - x | C | x | x | M |
1.6 x 10-7 = (x)(x)/(0.20-x)
x2 = (0.20)(1.6 x 10-7) = 3.2 x 10-8
x = 1.78 x 10-4 M = [OH-]
pH = 14.00 - (-log(1.78 x 10-4)) = 14.00-3.75 = 10.25
Na2HPO4 is a basic salt.
X. Lewis acid-base model
A more general description of acid-base behavior.
A. DefinitionAcid: an electron pair acceptor
Base: an electron pair donor
This definition does not depend on the action of protons to explain behavior.
B. Determining Lewis acids and bases1. Draw Lewis dot structures of acid and baseC. Examples
2. Show interacxtion of acid and base with Lewis dot structures
3. ID the electron pair donor (LB) and the electron pair acceptor (LA)1. Water: H+ + OH- <--> H2O

2. Complex ions: Cu(NH3)42+

XI. Acid strength and molecular structure
A. Hydrides of elements1. Two important factors determining relative acid strengtha. electronegativity of the element2. Trends observed: second row of the Periodic table
b. size of the element
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
As the electronegativity increases, the bond first becomes more covalent (start as ionic with M+ and H-), then becomes more polar and ionizable to H+ and X-.
3. Trends down a group
|
|
|
|
|
|
|
|
|
|
As the size increases, the ionizability of the X-H bond increases, and the acid strength increases.
A large atom is diffuse and polarizable; the small hydrogen atom is a 'pea in pudding'. The large atom can better stabilize a negative charge by spreading it out.
A small atom is hard and not as polarizable, like a billiard ball. The
smaller atom has a harder time stabilizing a negative charge.
B. Oxyacidsthird row of the Periodic table1. Formula: (H-O)n-Z
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Each oxygen is more electronegative than chlorine, so will draw electron density from Cl and make it more electron poor. This increases the ionizability of the O-H bond by further stabilizing the anion.2. Compare two ends of the Periodic tablea. NaOH: The Na-O bond is more easily ionized than the O-H bond (larger electronegativity difference), therefore get Na+ and OH- in solution.3. Trends down a group
b. H2SO4: The O-H bond(s) are more easily ionized than the S-O bond(s), therefore get H+ and HSO4- in solution.HOCl > HOBr > HOI (electronegativity decreases Cl > Br > I)4. Addition of oxygen atoms to the acid (groups of related oxyacids)HClO4 > HClO3 > HClO2 > HClO
5. General trendsa. As the electronegativity of Z increases, the acidity of the oxyacid increases.
b. As oxygen atoms are added, the acidity of the oxyacid increases.